Home
Products
Praeruptorin C
| Product Name | Praeruptorin C |
| Price: | $117 / 20mg |
| Catalog No.: | CN06281 |
| CAS No.: | 72463-77-5 |
| Molecular Formula: | C24H28O7 |
| Molecular Weight: | 428.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Peucedanum praeruptorum Dunn. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC=C(C(=O)OC1C(OC(=O)CC(C)C)c2c(OC1(C)C)ccc1c2oc(=O)cc1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Praeruptorin C is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin C is a calcium antagonist with pD2′ value of 5.7[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 516.5±50.0 °C at 760 mmHg |
| Flash Point | 221.4±30.2 °C |
| Exact Mass | 428.183502 |
| PSA | 92.04000 |
| LogP | 5.59 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8C |