Home
Products
3-Methoxyflavon
| Product Name | 3-Methoxyflavon |
| Price: | Inquiry |
| Catalog No.: | CN04379 |
| CAS No.: | 7245-02-5 |
| Molecular Formula: | C16H12O3 |
| Molecular Weight: | 252.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Artemisia incanescens. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(oc2c(c1=O)cccc2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Methoxyflavone is a flavonoid compound isolated from Artemisia incanescens with antiviral activity[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 408.4±45.0 °C at 760 mmHg |
| Flash Point | 192.4±15.1 °C |
| Exact Mass | 252.078644 |
| PSA | 39.44000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |