Home
Products
Licoflavone C
| Product Name | Licoflavone C |
| Price: | $219 / 5mg |
| Catalog No.: | CN05070 |
| CAS No.: | 72357-31-4 |
| Molecular Formula: | C20H18O5 |
| Molecular Weight: | 338.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Glycyrrhiza inflata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)cc(c2c1oc(cc2=O)c1ccc(cc1)O)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Licoflavone C is a prenyl-flavone extracted from Genista ephedroides, reduces the genotoxicity of cancer drugs in human peripheral lymphocytes[1]. |
| Exact Mass | 338.11500 |
| PSA | 90.90000 |
| LogP | 4.08550 |
| Storage condition | 2-8°C |