Home
Products
Malvidin-3-O-glucoside chloride
| Product Name | Malvidin-3-O-glucoside chloride |
| Price: | $293 / 5mg |
| Catalog No.: | CN05122 |
| CAS No.: | 7228-78-6 |
| Molecular Formula: | C23H25ClO12 |
| Molecular Weight: | 528.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2cc(OC)c(c(c2)OC)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Malvidin-3-glucoside chloride (Malvidin-3-O-glucoside chloride), a major wine anthocyanin, is effective in promoting resilience against stress by modulating brain synaptic plasticity and peripheral inflammation[1]. |
| Boiling Point | 180-190ºC at 0.25 MM HG |
| Exact Mass | 528.103455 |
| PSA | 191.67000 |
| Storage condition | ?20°C |