Home
Products
Spinosin
| Product Name | Spinosin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05512 |
| CAS No.: | 72063-39-9 |
| Molecular Formula: | C28H32O15 |
| Molecular Weight: | 608.55 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Ziziphus jujuba |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)c1c(OC)cc2c(c1O)c(=O)cc(o2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Spinosyn a C-glycoside flavonoid isolated from the seeds of Zizyphus jujube, with neuroprotective effects. Spinosin inhibits Aβ1-42 production and aggregation via activating Nrf2/HO-1 pathway[1][2][3]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 901.4±65.0 °C at 760 mmHg |
| Flash Point | 296.7±27.8 °C |
| Exact Mass | 608.174133 |
| PSA | 249.20000 |
| LogP | -1.04 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |