Home
Products
Sylvestroside I
| Product Name | Sylvestroside I |
| Price: | $351 / 5mg |
| Catalog No.: | CN03136 |
| CAS No.: | 71431-22-6 |
| Molecular Formula: | C33H48O19 |
| Molecular Weight: | 748.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Dipsacus asperoides |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCCC1C(C=C)C(OC=C1C(=O)OC1CC2C(C1C)C(OC=C2C(=O)OC)OC1OC(CO)C(C(C1O)O)O)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sylvestroside I is an iridoid isolated from Acicarpha tribuloides[1]. |
| Density | 1.55±0.1 g/cm3 |
| Boiling Point | 929.2±65.0 °C at 760 mmHg |
| Flash Point | 287.7±27.8 °C |
| Exact Mass | 748.278992 |
| PSA | 290.05000 |
| LogP | -4.56 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |