Home
Products
7,3',4'-Tri-O-methyleriodictyol
| Product Name | 7,3',4'-Tri-O-methyleriodictyol |
| Price: | Inquiry |
| Catalog No.: | CN04647 |
| CAS No.: | 70987-96-1 |
| Molecular Formula: | C18H18O6 |
| Molecular Weight: | 330.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The whole plants of Pogostemon cablin. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2OC(CC(=O)c2c(c1)O)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7,3′,4′-Tri-O-methyleriodictyol is a flavonoid with an antimutagenic activity. 7,3′,4′-Tri-O-methyleriodictyol inhibits the furylfuramide-induced SOS response and has potency as bioantimutagens[1]. |
| Exact Mass | 330.11000 |
| PSA | 74.22000 |
| LogP | 3.12450 |