Home
Products
Isoxanthohumol
| Product Name | Isoxanthohumol |
| Price: | $62 / 10mg |
| Catalog No.: | CN04852 |
| CAS No.: | 70872-29-6 |
| Molecular Formula: | C21H22O5 |
| Molecular Weight: | 354.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens Ait. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c2c1C(=O)CC(O2)c1ccc(cc1)O)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (2S)-Isoxanthohumol is a microbial biotransformed metabolite of the hop prenylflavanone Isoxanthohumol[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 585.8±50.0 °C at 760 mmHg |
| Flash Point | 208.6±23.6 °C |
| Exact Mass | 354.146729 |
| PSA | 75.99000 |
| LogP | 5.07 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |