Home
Products
Cyanidin-3-O-glucoside chloride
| Product Name | Cyanidin-3-O-glucoside chloride |
| Price: | $77 / 20mg |
| Catalog No.: | CN05497 |
| CAS No.: | 7084-24-4 |
| Molecular Formula: | C21H21O11 |
| Molecular Weight: | 449.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Red powder |
| Source: | The herbs of Chrysanthemum indicum |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2ccc(c(c2)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kuromanin (chloride), extracted from mulberry leaves, has been shown to improve blood glucose concentrations and lipid homeostasis and to reduce obesity. |
| Exact Mass | 484.077240 |
| PSA | 193.44000 |
| Storage condition | −20°C |