Home
Products
Catharanthine Sulfate
| Product Name | Catharanthine Sulfate |
| Price: | Inquiry |
| Catalog No.: | CN01042 |
| CAS No.: | 70674-90-7 |
| Molecular Formula: | C21H26N2O6S |
| Molecular Weight: | 434.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Catharanthus roseus (L.) G.Don |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OS(=O)(=O)O.CCC1=CC2CN3C1C(C2)(C(=O)OC)c1[nH]c2c(c1CC3)cccc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 434.151154 |
| PSA | 128.31000 |
| LogP | 3.54120 |
| Storage condition | 2-8°C |