Home
Products
Chrysoobtusin
| Product Name | Chrysoobtusin |
| Price: | $146 / 10mg |
| Catalog No.: | CN05920 |
| CAS No.: | 70588-06-6 |
| Molecular Formula: | C19H18O7 |
| Molecular Weight: | 358.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The seeds of Senna surattensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c(c1OC)C(=O)c1c(C2=O)cc(c(c1OC)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Chrysoobtusin is an anthraquinone derivative isolated from Semen Cassiae. Semen Cassiae has long been used to protect liver, brighten eyes, and relieve constipation[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 586.2±50.0 °C at 760 mmHg |
| Flash Point | 212.4±23.6 °C |
| Exact Mass | 358.105255 |
| PSA | 91.29000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8℃ |