Home
Products
Obtusin
| Product Name | Obtusin |
| Price: | $117 / 5mg |
| Catalog No.: | CN05943 |
| CAS No.: | 70588-05-5 |
| Molecular Formula: | C18H16O7 |
| Molecular Weight: | 344.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia obtusifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c(c1O)C(=O)c1c(C2=O)cc(c(c1OC)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Obtusin, isolated from Cassia obtusifolia Linn seed, is a highly selective and competitive human monoamine oxidase-A (hMAO-A) inhibitor with an IC50 of 11.12 μM and a Ki of 6.15. Obtusin plays a preventive role in neurodegenerative diseases, especially anxiety and depression[1]. |
| Target | IC50: 11.12 μM (hMAO-A)[1] Ki: 6.15 (hMAO-A)[1] |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 614.9±55.0 °C at 760 mmHg |
| Flash Point | 227.0±25.0 °C |
| Exact Mass | 344.089600 |
| PSA | 102.29000 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Storage condition | 2-8℃ |