Home
Products
Yunaconitine
| Product Name | Yunaconitine |
| Price: | Inquiry |
| Catalog No.: | CN02201 |
| CAS No.: | 70578-24-4 |
| Molecular Formula: | C35H49NO11 |
| Molecular Weight: | 659.77 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COCC12CN(CC)C3C4(C2C(OC)C3C2(C3C4CC(C3OC(=O)c3ccc(cc3)OC)(C(C2)OC)O)OC(=O)C)C(CC1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Yunaconitine(Guayewuanine B) is a highly toxic aconitum alkaloid. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 722.8±60.0 °C at 760 mmHg |
| Flash Point | 390.9±32.9 °C |
| Exact Mass | 659.330566 |
| PSA | 142.45000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Storage condition | 2-8℃ |