Home
Products
20(S),24(R)-Ocotillol
| Product Name | 20(S),24(R)-Ocotillol |
| Price: | Inquiry |
| Catalog No.: | CN07524 |
| CAS No.: | 69926-31-4 |
| Molecular Formula: | C30H52O5 |
| Molecular Weight: | 492.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC[C@H]2[C@@]1(C)CC[C@@H]2[C@@H]1CC[C@@H](OC1)C(O)(C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 20(S),24(R)-Ocotillol is isolated from Panax ginseng[1]. |
| Density | 1.126±0.06 g/cm3(Predicted) |
| Boiling Point | 594.5±50.0 °C(Predicted) |