Home
Products
Swertisin
| Product Name | Swertisin |
| Price: | Inquiry |
| Catalog No.: | CN04908 |
| CAS No.: | 6991-10-2 |
| Molecular Formula: | C22H22O10 |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Swertia bimaculata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(OC)cc2c(c1O)c(=O)cc(o2)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Swertisin, a C-glucosylflavone isolated from Swertia japonica, is known to have antidiabetic, anti-inflammatory and antioxidant effects. Swertisin is an adenosine A1 receptor antagonist[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 798.1±60.0 °C at 760 mmHg |
| Flash Point | 279.7±26.4 °C |
| Exact Mass | 462.116211 |
| PSA | 179.28000 |
| LogP | -1.03 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |