Home
Products
Atractylone
| Product Name | Atractylone |
| Price: | $89 / 20mg |
| Catalog No.: | CN09340 |
| CAS No.: | 6989-21-5 |
| Molecular Formula: | C15H20O |
| Molecular Weight: | 216.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Soild |
| Source: | The roots of Atractylodes macrocephala |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1CCC[C@]2([C@H]1Cc1c(C2)occ1C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atractylone (Atractylon) is a sesquiterpenoid extracted from Atractylodis Rhizoma. Atractylone (Atractylon) alleviates influenza A virus (IAV)-induced lung injury via regulating the TLR7 signaling pathway, and acts as a promising agent for IAV treatment. Atractylone (Atractylon) inhibits the degranulation of mast cell and exhibits potential for the treatment of mast cell-mediated allergic reactions[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 287.1±19.0 °C at 760 mmHg |
| Flash Point | 121.7±8.3 °C |
| Exact Mass | 216.151413 |
| PSA | 13.14000 |
| LogP | 5.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |