Home
Products
Petunidin-3-O-glucoside chloride
| Product Name | Petunidin-3-O-glucoside chloride |
| Price: | Inquiry |
| Catalog No.: | CN05128 |
| CAS No.: | 6988-81-4 |
| Molecular Formula: | C22H23ClO12 |
| Molecular Weight: | 514.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2cc(O)c(c(c2)OC)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Petunidin-3-O-glucoside chloride is a flavonoid isolated from Phaseolus vulgaris L. seed, has antioxidant activity[1] |
| Exact Mass | 514.08800 |
| PSA | 202.67000 |
| LogP | 1.19260 |
| Storage condition | ?20°C |