Home
Products
Bixin
| Product Name | Bixin |
| Price: | $351 / 5mg |
| Catalog No.: | CN06350 |
| CAS No.: | 6983-79-5 |
| Molecular Formula: | C25H30O4 |
| Molecular Weight: | 394.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Artocarpus tonkinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)/C=C/C(=CC=CC(=CC=CC=C(C=CC=C(C=CC(=O)O)/C)/C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bixin (BX), isolated from the seeds of Bixa orellana, is a carotenoid, possessing anti-inflammatory, anti-tumor and anti-oxidant activities. Bixin treatment ameliorated cardiac dysfunction through inhibiting fibrosis, inflammation and reactive oxygen species (ROS) generation[1]. |
| Density | 1.035 g/cm3 |
| Boiling Point | 596ºC at 760 mmHg |
| Flash Point | 197.8ºC |
| Exact Mass | 394.21400 |
| PSA | 63.60000 |
| LogP | 5.81020 |
| Storage condition | -20°C |