Home
Products
Agarotetrol
| Product Name | Agarotetrol |
| Price: | $58 / 10mg |
| Catalog No.: | CN03683 |
| CAS No.: | 69809-22-9 |
| Molecular Formula: | C17H18O6 |
| Molecular Weight: | 318.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Aquilaria sinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1[C@H](O)[C@@H](O)c2c([C@H]1O)oc(cc2=O)CCc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Agarotetrol is a chromone derivative isolated from Agarwood. |
| In Vitro | Agarotetrol is a chromone derivative isolated from Agarwood, shows no inhibitory activity against phosphodiesterase (PDE) 3A (IC50, >100 μM). |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 581.3±50.0 °C at 760 mmHg |
| Flash Point | 216.5±23.6 °C |
| Exact Mass | 318.110352 |
| PSA | 111.13000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8℃ |