Home
Products
Swertiajaponin
| Product Name | Swertiajaponin |
| Price: | $380 / 10mg |
| Catalog No.: | CN04901 |
| CAS No.: | 6980-25-2 |
| Molecular Formula: | C22H22O11 |
| Molecular Weight: | 462.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Swertia mileensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2c(OC)cc3c(c2O)c(=O)cc(o3)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Swertiajaponin is a tyrosinase inhibitor, forms multiple hydrogen bonds and hydrophobic interactions with the binding pocket of tyrosinase, with an IC50 of 43.47 μM. Swertiajaponin also inhibits oxidative stress-mediated MAPK/MITF signaling, leading to decrease in tyrosinase protein level. Swertiajaponin suppresses melanin accumulation and exhibits strong anti-oxidative activity[1]. |
| Target | IC50: 43.47 μM (tyrosinase)[1] |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 761.3±60.0 °C at 760 mmHg |
| Flash Point | 266.6±26.4 °C |
| Exact Mass | 462.116211 |
| PSA | 190.28000 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Storage condition | 2-8℃ |