Home
Products
Oleaside A
| Product Name | Oleaside A |
| Price: | $366 / 5mg |
| Catalog No.: | CN02391 |
| CAS No.: | 69686-84-6 |
| Molecular Formula: | C30H44O7 |
| Molecular Weight: | 516.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Nerium oleander |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO[C@@H]1C[C@H](O[C@H]2CC[C@]3([C@@H](C2)CC[C@]24[C@@H]3CC[C@](C4=O)(C)[C@H](CC2)C2=CC(=O)OC2)C)O[C@@H]([C@@H]1O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oleaside A is a polar cardenolide monoglycoside isolated from Nerium oleander, inhibits the induction of ICAM-1 induced by IL-1α and TNF-α, and has anti-tumor activity[1]. |
| Density | 1.22g/cm3 |
| Boiling Point | 672.3ºC at 760 mmHg |
| Flash Point | 216.3ºC |
| Exact Mass | 516.30900 |
| PSA | 91.29000 |
| LogP | 4.34760 |