Home
Products
8-O-Acetylharpagide
| Product Name | 8-O-Acetylharpagide |
| Price: | $80 / 20mg |
| Catalog No.: | CN03130 |
| CAS No.: | 6926-14-3 |
| Molecular Formula: | C17H26O11 |
| Molecular Weight: | 406.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Scrophularia ningpoensis Hemsl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C[C@@]3([C@H]2[C@@](C)(OC(=O)C)C[C@H]3O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 8-O-Acetylharpagide is an iridoid isolated from Ajuga reptans with antitumoral, antiviral, antibacterial, and anti-inflammatory activities. 8-O-Acetylharpagide also has a biological activity on isolated smooth muscle preparations from guinea pig[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 607.2±55.0 °C at 760 mmHg |
| Flash Point | 215.9±25.0 °C |
| Exact Mass | 406.147522 |
| PSA | 175.37000 |
| LogP | -3.48 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Storage condition | ?20°C |