Home
Products
Pinoresinol 4-O-beta-D-glucopyranoside
| Product Name | Pinoresinol 4-O-beta-D-glucopyranoside |
| Price: | $146 / 10mg |
| Catalog No.: | CN02918 |
| CAS No.: | 69251-96-3 |
| Molecular Formula: | C26H32O11 |
| Molecular Weight: | 520.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Polygonatum sibiricum Red. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2ccc(cc2OC)C2OCC3C2COC3c2ccc(c(c2)OC)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinoresinol 4-O-β-D-glucopyranoside ((+)-Pinoresinol 4-O-β-D-glucopyranoside) is the major active furofuran type lignans in Fructus Forsythiae. Pinoresinol 4-O-β-D-glucopyranoside shows antioxidant, blood pressure reducing, and cyclic adenosine monophosphate (cAMP) phosphodiesterase inhibitory effects[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 752.5±60.0 °C at 760 mmHg |
| Flash Point | 408.9±32.9 °C |
| Exact Mass | 520.194458 |
| PSA | 156.53000 |
| LogP | -0.69 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | 2-8°C |