Home
Products
Luteolin-4'-O-glucoside
| Product Name | Luteolin-4'-O-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN04481 |
| CAS No.: | 6920-38-3 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Kummerowia striata Thunb. (Leguminosae). |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1OC(Oc2ccc(cc2O)c2cc(=O)c3c(o2)cc(cc3O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Luteolin-4'-O-glucoside is an IL-5 inhibitor with an IC50 of 3.7 μM. Luteolin-4'-O-glucoside resists hyperuricemia and acute gouty arthritis activity. Luteolin-4'-O-glucoside shows anticancer activity[1][2][3]. |
| Target | IC50: 3.7 μM (IL-5)[1] |
| In Vitro | Luteolin-4'-O-glucoside shows cytotoxic activity against NCI-H929, U266, and OPM2 cell lines[3]. |
| Density | 1.713g/cm3 |
| Boiling Point | 814.5ºC at 760 mmHg |
| Flash Point | 288.5ºC |
| Exact Mass | 448.10100 |
| PSA | 190.28000 |