Home
Products
Acetoxyisovalerylalkannin
| Product Name | Acetoxyisovalerylalkannin |
| Price: | $219 / 10mg |
| Catalog No.: | CN05891 |
| CAS No.: | 69091-17-4 |
| Molecular Formula: | C23H26O8 |
| Molecular Weight: | 430.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Oil |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(CC(OC(=O)C)(C)C)O[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Beta-Acetoxyisovalerylshikonin is a naphthoquinone derivative isolated from Arnebia euchroma[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 583.6±50.0 °C at 760 mmHg |
| Flash Point | 196.5±23.6 °C |
| Exact Mass | 430.162781 |
| PSA | 127.20000 |
| LogP | 5.54 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |