Home
Products
Peonidin-3-O-glucoside chloride
| Product Name | Peonidin-3-O-glucoside chloride |
| Price: | Inquiry |
| Catalog No.: | CN05125 |
| CAS No.: | 6906-39-4 |
| Molecular Formula: | C22H23ClO11 |
| Molecular Weight: | 498.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3c(O)cc(cc3[o+]c2c2ccc(c(c2)OC)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Peonidin 3-O-glucoside chloride, an anthocyanin, act as an insulin secretagogue. Peonidin 3-O-glucoside chloride can increase glucose uptake in HepG2 cells. Peonidin 3-O-glucoside chloride has the potential for type-2 diabetes comorbidities research[1]. |
| Exact Mass | 498.09300 |
| PSA | 182.44000 |
| Storage condition | −20°C |