Home
Products
Germacrone
| Product Name | Germacrone |
| Price: | $46 / 20mg |
| Catalog No.: | CN09463 |
| CAS No.: | 6902-91-6 |
| Molecular Formula: | C15H22O |
| Molecular Weight: | 218.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The rhizomes of Curcuma wenyujin. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C/1=CCC(=C(C)C)C(=O)C/C(=C/CC1)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Germacrone is extracted from Rhizoma Curcuma. Germacrone inhibits influenza virus infection[1]. |
| Target | Influenza virus[1] |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 330.3±42.0 °C at 760 mmHg |
| Flash Point | 148.4±18.7 °C |
| Exact Mass | 218.167068 |
| PSA | 17.07000 |
| LogP | 4.76 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Storage condition | 2-8°C |