Home
Products
2,6-Dihydroxypurine
| Product Name | 2,6-Dihydroxypurine |
| Price: | $15 / 20mg |
| Catalog No.: | CN00081 |
| CAS No.: | 69-89-6 |
| Molecular Formula: | C5H4N4O2 |
| Molecular Weight: | 152.11 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1[nH]c(=O)c2c([nH]1)nc[nH]2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthine is a purine base found in most human body tissues and fluids and in other organisms. |
| Target | Human Endogenous Metabolite |
| In Vitro | A number of stimulants are derived from Xanthine including caffeine and theobromine. Xanthine is a product on the pathway of purine degradation. Xanthine is subsequently converted to uric acid by the action of the Xanthine oxidase enzyme. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 834.9ºC at 760 mmHg |
| Flash Point | 458.7ºC |
| Exact Mass | 152.033432 |
| PSA | 94.40000 |
| LogP | -0.81 |
| Storage condition | Store at RT. |