Home
Products
Maltose
| Product Name | Maltose |
| Price: | $12 / 20mg |
| Catalog No.: | CN06359 |
| CAS No.: | 69-79-4 |
| Molecular Formula: | C12H22O11 |
| Molecular Weight: | 342.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Triticum aestivum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1O[C@@H](O)[C@@H]([C@H]([C@@H]1O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maltose is a disaccharide formed from two units of glucose joined with an α(1→4) bond. Maltose is a reducing sugar. |
| Target | Human Endogenous Metabolite |
| In Vitro | Maltose is the two-unit member of the amylose homologous series, the key structural motif of starch. When beta-amylase breaks down starch, it removes two glucose units at a time, producing maltose. In the isomer isomaltose, the two glucose molecules are joined with an α(1→6) bond. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 667.9±55.0 °C at 760 mmHg |
| Flash Point | 357.8±31.5 °C |
| Exact Mass | 342.116211 |
| PSA | 189.53000 |
| LogP | -3.41 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Storage condition | 2-8°C |