Home
Products
Dipotassium Glycyrrhizinate
| Product Name | Dipotassium Glycyrrhizinate |
| Price: | $46 / 20mg |
| Catalog No.: | CN07256 |
| CAS No.: | 68797-35-3 |
| Molecular Formula: | C42H62K2O17 |
| Molecular Weight: | 917.13 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Glycyrrhiza glabra. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC1C(OC2OC(C(=O)[O-])C(C(C2O)O)O)C(OC(C1O)C(=O)[O-])OC1CCC2(C(C1(C)C)CCC1(C2C(=O)C=C2C1(C)CCC1(C2CC(C)(CC1)C(=O)O)C)C)C.[K+].[K+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dipotassium glycyrrhizinate is a natural compound, inhibits atopic dermatitis-related gene expression with anti-anti-inflammatory activity[1]. |
| Exact Mass | 898.315552 |
| PSA | 272.70000 |