Home
Products
Tuberostemonine
| Product Name | Tuberostemonine |
| Price: | Inquiry |
| Catalog No.: | CN02080 |
| CAS No.: | 6879-01-2 |
| Molecular Formula: | C22H33NO4 |
| Molecular Weight: | 375.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Stemona japonica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@H]1[C@H]2CCCCN3[C@H]2[C@@H]([C@@H]2[C@H]1OC(=O)[C@H]2C)C[C@H]3[C@@H]1C[C@@H](C(=O)O1)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tuberstemonine, an alkaloid, is an antimalarial agent that targets Plasmodium falciparum ferredoxin-NADP+ reductases (pfFNR)[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 554.2±50.0 °C at 760 mmHg |
| Flash Point | 289.0±30.1 °C |
| Exact Mass | 375.240967 |
| PSA | 55.84000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8C |