Home
Products
Arborine
| Product Name | Arborine |
| Price: | $293 / 10mg |
| Catalog No.: | CN00873 |
| CAS No.: | 6873-15-0 |
| Molecular Formula: | C16H14N2O |
| Molecular Weight: | 250.30 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Glycosmis pentaphylla. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1nc(Cc2ccccc2)n(c2c1cccc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Arborine, isolated from Glycosmis arborea, inhibits the peripheral action of acetylcholine and induces a fall in blood pressure[1][1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 421.0±38.0 °C at 760 mmHg |
| Flash Point | 208.4±26.8 °C |
| Exact Mass | 250.110611 |
| PSA | 34.89000 |
| LogP | 2.25 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |