Home
Products
Asimilobine
| Product Name | Asimilobine |
| Price: | Inquiry |
| Catalog No.: | CN00913 |
| CAS No.: | 6871-21-2 |
| Molecular Formula: | C17H17NO2 |
| Molecular Weight: | 267.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The stems and leaves of Fissistigma oldhamii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c3c1c1ccccc1C[C@H]3NCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Asimilobine is an aporphine isoquinoline alkaloid isolated from plant species of Magnolia obobata Thun. Asimilobine is a dopamine biosynthesis inhibitor and a serotonergic receptor antagonist. Asimilobine shows an antimalarial and anti-cancer activity[1][2]. |
| Target | Dopamine Receptor serotonergic receptor |
| In Vitro | Asimilobine (0.05-0.2 μM; for 24 h) shows a significant inhibition of intracellular dopamine levels in a concentration-dependent manner with an IC50 value of 0.13 μM[2]. Asimilobine (0.15 μM) inhibits tyrosine hydroxylase (TH) and aromatic L-amino acid decarboxylase (AADC) activities at 24 h[2]. Asimilobine also decreases TH mRNA levels and intracellular cyclic AMP levels[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 472.5±45.0 °C at 760 mmHg |
| Flash Point | 239.6±28.7 °C |
| Exact Mass | 267.125916 |
| PSA | 41.49000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |