Home
Products
N-(p-Coumaroyl) serotonin
| Product Name | N-(p-Coumaroyl) serotonin |
| Price: | $321 / 5mg |
| Catalog No.: | CN00715 |
| CAS No.: | 68573-24-0 |
| Molecular Formula: | C19H18N2O3 |
| Molecular Weight: | 322.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The seeds of Griffonia simplicifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(/C=C/c1ccc(cc1)O)NCCc1c[nH]c2c1cc(O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-(p-Coumaroyl) Serotonin is a polyphenol isolated from the seeds of safflower and has antioxidative, anti-atherogenic and anti-inflammatory properties. N-(p-Coumaroyl) Serotonin inhibits PDGF-induced on phosphorylation of PDGF receptor and Ca2+ release from sarcoplasmic reticulum[1]. N-(p-Coumaroyl) Serotonin ameliorates atherosclerosis and distensibility of the aortic wall in vivo and is usually used for the atherosclerosis research[2]. |
| Density | 1.346g/cm3 |
| Boiling Point | 694.2ºC at 760 mmHg |
| Flash Point | 373.6ºC |
| Exact Mass | 322.13200 |
| PSA | 85.35000 |
| LogP | 3.34210 |