Home
Products
Moschamine
| Product Name | Moschamine |
| Price: | $424 / 10mg |
| Catalog No.: | CN01193 |
| CAS No.: | 68573-23-9 |
| Molecular Formula: | C20H20N2O4 |
| Molecular Weight: | 352.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Datura stramonium Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(C=CC(=O)NCCc2c[nH]c3c2cc(O)cc3)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-Feruloylserotonin, an antioxidative component and bioactive serotonin derivative, from the Seed of Carthamus tinctorius L., ameliorates atherosclerosis and distensibility of the aortic wall in Kurosawa and Kusanagi-hypercholesterolemic (KHC) rabbits[1]. |
| Density | 1.338g/cm3 |
| Boiling Point | 705.6ºC at 760 mmHg |
| Flash Point | 380.5ºC |
| Exact Mass | 352.14200 |
| PSA | 94.58000 |
| LogP | 3.35070 |