Home
Products
20-O-Glucoginsenoside Rf
| Product Name | 20-O-Glucoginsenoside Rf |
| Price: | $351 / 5mg |
| Catalog No.: | CN07307 |
| CAS No.: | 68406-27-9 |
| Molecular Formula: | C48H82O19 |
| Molecular Weight: | 963.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Panax ginseng C. A. Mey. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@H]2C[C@]3(C)[C@@H]([C@@]4([C@@H]2C(C)(C)[C@@H](O)CC4)C)C[C@H]([C@H]2[C@@]3(C)CC[C@@H]2[C@@](O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)(CCC=C(C)C)C)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 1045.5±65.0 °C at 760 mmHg |
| Flash Point | 586.1±34.3 °C |
| Exact Mass | 962.545044 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |