Home
Products
Kuwanon E
| Product Name | Kuwanon E |
| Price: | $511 / 5mg |
| Catalog No.: | CN05067 |
| CAS No.: | 68401-05-8 |
| Molecular Formula: | C25H28O6 |
| Molecular Weight: | 424.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCc1cc(c(cc1O)O)C1CC(=O)c2c(O1)cc(cc2O)O)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kuwanon E is a flavonoid isolated from Morus alba, cytotoxic to human monocytic leukemic cell lines, and reduces the level of IL-1β[1]. |
| Target | Kuwanon E shows cytotoxic activity against THP-1 human monocytic leukemic cell line, with an IC50 of 4.0±0.08 μM[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 678.3±55.0 °C at 760 mmHg |
| Flash Point | 232.0±25.0 °C |
| Exact Mass | 424.188599 |
| PSA | 107.22000 |
| LogP | 6.60 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |