Home
Products
Micheliolide
| Product Name | Micheliolide |
| Price: | $117 / 10mg |
| Catalog No.: | CN09046 |
| CAS No.: | 68370-47-8 |
| Molecular Formula: | C15H20O3 |
| Molecular Weight: | 248.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Michelia compressa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=C2CC[C@@]([C@@H]2[C@@H]2[C@@H](CC1)C(=C)C(=O)O2)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Micheliolide could effectively attenuate the high glucose-stimulated activation of NF-κB, the degradation of IκBα, and the expression of MCP-1, TGF-β1 and FN in rat mesangial cells (MCs). |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 426.1±45.0 °C at 760 mmHg |
| Flash Point | 181.8±21.5 °C |
| Exact Mass | 248.141251 |
| PSA | 46.53000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Storage condition | -20°C |