Home
Products
Deltaline
| Product Name | Deltaline |
| Price: | Inquiry |
| Catalog No.: | CN02025 |
| CAS No.: | 6836-11-9 |
| Molecular Formula: | C27H41NO8 |
| Molecular Weight: | 507.62 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1CC23OCOC43C(OC(=O)C)C3C5(C6(CC1C(C26)OC)O)C4N(CC)CC3(C)CCC5OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deltaline is a diterpenoid alkaloid and isolated from plants of the genus Delphinium delavayi Franch. Deltaline itself has analgesic properties, and plants of the genus Delphinium delavayi Franch have also been therapeutically used to treat rheumaticpain, paralysis due to stroke, rheumatoid arthritis[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 597.6±50.0 °C at 760 mmHg |
| Flash Point | 315.2±30.1 °C |
| Exact Mass | 507.283203 |
| PSA | 95.92000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Storage condition | 2-8C |