Home
Products
6-Prenylnaringenin
| Product Name | 6-Prenylnaringenin |
| Price: | $219 / 5mg |
| Catalog No.: | CN05145 |
| CAS No.: | 68236-13-5 |
| Molecular Formula: | C20H20O5 |
| Molecular Weight: | 340.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Humulus lupulus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)cc2c(c1O)C(=O)C[C@H](O2)c1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (2S)-6-Prenylnaringenin is the most efficient compound in forebrain. (2S)-6-Prenylnaringenin acts as a GABAA positive allosteric modulator at α+β- binding interface[1]. |
| In Vitro | (2S)-6-Prenylnaringenin (6-Prenylnaringenin) displays a modulatory activity at low micromolar concentrations. (2S)-6-Prenylnaringenin potentiates GABA-induced displacement of [3H]EBOB binding in a concentration-dependent manner where the IC50 value for this potentiation in native GABAA receptors is 3.7 μM, respectively[1]. |
| Density | 1.314±0.06 g/cm3 |
| Exact Mass | 340.13100 |
| PSA | 86.99000 |
| LogP | 4.01860 |
| Storage condition | 2-8°C |