Home
Products
Isoliensinine
| Product Name | Isoliensinine |
| Price: | $62 / 20mg |
| Catalog No.: | CN02180 |
| CAS No.: | 6817-41-0 |
| Molecular Formula: | C37H42N2O6 |
| Molecular Weight: | 610.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The plantule of Nelumbo nucifera Gaertn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)CC1N(C)CCc2c1cc(Oc1cc(ccc1O)CC1N(C)CCc3c1cc(O)c(c3)OC)c(c2)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoliensinine is a bisbenzylisoquinoline alkaloid extracted from the seed embryo of Nelumbo nucifera, with anti-oxidant and anti-inflammatory and anti-cancer activities. Isoliensinine induces apoptosis in triple-negative human breast cancer cells[1][2]. |
| In Vitro | Isoliensinine induces apoptosis in triple-negative human breast cancer cells through ROS generation and p38 MAPK/JNK activation[1]. Isoliensinine exerts antiproliferative effect on CASMCs induced by phenylephrine, and its mechanisms are related to decrease the overexpression of growth factors (PDGF-beta, bFGF), protooncogene (c-fos, c-myc) and hsp70[3]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 723.1±60.0 °C at 760 mmHg |
| Flash Point | 391.1±32.9 °C |
| Exact Mass | 610.304260 |
| PSA | 83.86000 |
| LogP | 4.72 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2-8°C |