Home
Products
1-O-Acetyl britannilactone
| Product Name | 1-O-Acetyl britannilactone |
| Price: | $351 / 10mg |
| Catalog No.: | CN09372 |
| CAS No.: | 681457-46-5 |
| Molecular Formula: | C17H24O5 |
| Molecular Weight: | 266.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Inula japonica Thunb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCCCC(C1=C(C)CC2C(C1O)C(=C)C(=O)O2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 481.7±45.0 °C at 760 mmHg |
| Flash Point | 172.5±22.2 °C |
| Exact Mass | 308.162384 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |