Home
Products
Humic acid sodium salt
| Product Name | Humic acid sodium salt |
| Price: | Inquiry |
| Catalog No.: | CN06709 |
| CAS No.: | 68131-04-4 |
| Molecular Formula: | C9H8O4Na2 |
| Molecular Weight: | 226.14 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Oryza sativa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | [O-]C(=O)C1C2C=CC(C1C(=O)[O-])C2.[Na+].[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 226.021805 |
| PSA | 80.26000 |