Home
Products
Magnocurarine
| Product Name | Magnocurarine |
| Price: | Inquiry |
| Catalog No.: | CN01035 |
| CAS No.: | 6801-40-7 |
| Molecular Formula: | C19H24NO3 |
| Molecular Weight: | 314.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Magnolia officinalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CC[N+]([C@@H](c2cc1O)Cc1ccc(cc1)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Magnocurarine a natural compound isolated from Tiliacora racemosa[1]. |
| Exact Mass | 314.175079 |
| PSA | 49.69000 |
| LogP | -1.91 |