Home
Products
Aurantio-obtusin
| Product Name | Aurantio-obtusin |
| Price: | $62 / 20mg |
| Catalog No.: | CN05998 |
| CAS No.: | 67979-25-3 |
| Molecular Formula: | C17H14O7 |
| Molecular Weight: | 330.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia obtusifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2c(cc(c1O)C)C(=O)c1c(C2=O)c(O)c(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aurantio-obtusin is an anthraquinone isolated from Semen Cassiae, with anti-Inflammatory, anti-oxidative, anti-coagulating and anti-hypertension activities[1][2][3]. Aurantio-obtusin relaxes systemic arteries through endothelial PI3K/AKT/eNOS-dependent signaling pathway in rats, thus acts as a new potential vasodilator[2]. Aurantio-obtusin inhibits allergic responses in IgE-mediated mast cells and anaphylactic models and is potential for treatment for allergy-related diseases[3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 594.6±50.0 °C at 760 mmHg |
| Flash Point | 222.4±23.6 °C |
| Exact Mass | 330.073944 |
| PSA | 113.29000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2~8℃ |