Home
Products
Ambrox
| Product Name | Ambrox |
| Price: | Inquiry |
| Catalog No.: | CN08438 |
| CAS No.: | 6790-58-5 |
| Molecular Formula: | C16H28O |
| Molecular Weight: | 236.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | From ambergris produced by sperm whales. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1(C)CCC[C@]2([C@H]1CC[C@@]1([C@@H]2CCO1)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ambroxide is a naturally occurring terpenoid. Ambroxide is one of the key constituents of ambergris. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 273.9±8.0 °C at 760 mmHg |
| Flash Point | 104.8±15.3 °C |
| Exact Mass | 236.214020 |
| PSA | 9.23000 |
| LogP | 5.41 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |