Home
Products
Deapi-platycodin D3
| Product Name | Deapi-platycodin D3 |
| Price: | $293 / 10mg |
| Catalog No.: | CN07687 |
| CAS No.: | 67884-05-3 |
| Molecular Formula: | C58H94O29 |
| Molecular Weight: | 1255.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Platycodon grandiflorum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@H]3[C@@H](O)C[C@]4([C@H](C3(CO)CO)CC[C@@]3([C@@H]4CC=C4[C@@]3(C)C[C@H]([C@@]3([C@H]4CC(C)(C)CC3)C(=O)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O[C@@H]3OC[C@H]([C@@H]([C@H]3O)O)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Deapi-platycodin D3 is a triterpenoid saponin from the roots of Platycodon grandiflorum[1]. |
| Density | 1.6±0.1 g/cm3 |
| Exact Mass | 1254.588135 |
| LogP | -0.59 |
| Storage condition | 2-8℃ |