Home
Products
Platycodin D3
| Product Name | Platycodin D3 |
| Price: | $380 / 5mg |
| Catalog No.: | CN07257 |
| CAS No.: | 67884-03-1 |
| Molecular Formula: | C63H102O33 |
| Molecular Weight: | 1387.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Platycodon grandiflorum. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@H]3[C@@H](O)C[C@]4([C@H](C3(CO)CO)CC[C@@]3([C@@H]4CC=C4[C@@]3(C)C[C@H]([C@@]3([C@H]4CC(C)(C)CC3)C(=O)O[C@@H]3OC[C@@H]([C@@H]([C@H]3O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O[C@@H]3OC[C@H]([C@@H]([C@H]3O)O[C@@H]3OC[C@]([C@H]3O)(O)CO)O)O)O)O)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Platycodin D3 is a triterpenoid saponin isolated from Platycodon grandiflorum, with anti-HCV activity[1]. |
| Target | HCV[1] |
| Exact Mass | 1385.62000 |
| PSA | 532.43000 |