Home
Products
Caftaric acid
| Product Name | Caftaric acid |
| Price: | $62 / 10mg |
| Catalog No.: | CN06938 |
| CAS No.: | 67879-58-7 |
| Molecular Formula: | C13H12O9 |
| Molecular Weight: | 312.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Echinacea purpurea. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@H]([C@H](C(=O)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Caftaric acid is a natural product. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 618.2±55.0 °C at 760 mmHg |
| Flash Point | 236.3±25.0 °C |
| Exact Mass | 312.048126 |
| PSA | 161.59000 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8°C |