Home
Products
Alpha-caryophyllene
| Product Name | Alpha-caryophyllene |
| Price: | $62 / 50mg |
| Catalog No.: | CN09283 |
| CAS No.: | 6753-98-6 |
| Molecular Formula: | C15H24 |
| Molecular Weight: | 204.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The herbs of Humulus lupulus. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C/1=CCC(C)(C)/C=C/C/C(=C/CC1)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | α-Humulene is a main constituent of Tanacetum vulgare L. (Asteraceae) essential oil with anti-inflammation (IC50=15±2 µg/mL). α-Humulene inhibits COX-2 and iNOS expression[1]. |
| Target | COX-2 iNOS |
| In Vitro | The cytotoxicity of α-Humulene against human lung carcinoma A549, colon adenocarcinoma DLD-1, skin fibroblasts WS1 cell lines is 28±1, 43±3, and 24±3 µg/mL, respetctively[1]. |
| Density | 0.889 g/mL at 20 °C(lit.) |
| Boiling Point | 166-168 °C(lit.) |
| Flash Point | 90°C |
| Exact Mass | 204.18800 |
| LogP | 5.03540 |
| Storage condition | 2-8°C |